C12H16Cl4N2O2S — CID 120725705
2,3-dimethyl-1-(2,4,6-trichlorophenyl)sulfonylpiperazine;hydrochloride (PubChem CID 120725705) has the molecular formula C12H16Cl4N2O2S and a molecular weight of 394.15 g/mol. Its IUPAC name is 2,3-dimethyl-1-(2,4,6-trichlorophenyl)sulfonylpiperazine;hydrochloride.
| Compound Name | 2,3-dimethyl-1-(2,4,6-trichlorophenyl)sulfonylpiperazine;hydrochloride |
|---|---|
| PubChem CID | 120725705 |
| Molecular Formula | C12H16Cl4N2O2S |
| Molecular Weight | 394.15 g/mol |
| Exact Mass | 391.97 |
| IUPAC Name | 2,3-dimethyl-1-(2,4,6-trichlorophenyl)sulfonylpiperazine;hydrochloride |
| SMILES | CC1NCCN(S(=O)(=O)c2c(Cl)cc(Cl)cc2Cl)C1C.Cl |
| InChI | InChI=1S/C12H15Cl3N2O2S.ClH/c1-7-8(2)17(4-3-16-7)20(18,19)12-10(14)5-9(13)6-11(12)15;/h5-8,16H,3-4H2,1-2H3;1H |
| InChIKey | HQDMXDQZTKNEQZ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.15 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |