C12H17ClF2N2O2S — CID 120725989
1-(2,5-difluorophenyl)sulfonyl-2,3-dimethylpiperazine;hydrochloride (PubChem CID 120725989) has the molecular formula C12H17ClF2N2O2S and a molecular weight of 326.80 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)sulfonyl-2,3-dimethylpiperazine;hydrochloride.
| Compound Name | 1-(2,5-difluorophenyl)sulfonyl-2,3-dimethylpiperazine;hydrochloride |
|---|---|
| PubChem CID | 120725989 |
| Molecular Formula | C12H17ClF2N2O2S |
| Molecular Weight | 326.80 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | 1-(2,5-difluorophenyl)sulfonyl-2,3-dimethylpiperazine;hydrochloride |
| SMILES | CC1NCCN(S(=O)(=O)c2cc(F)ccc2F)C1C.Cl |
| InChI | InChI=1S/C12H16F2N2O2S.ClH/c1-8-9(2)16(6-5-15-8)19(17,18)12-7-10(13)3-4-11(12)14;/h3-4,7-9,15H,5-6H2,1-2H3;1H |
| InChIKey | RPITXJIDIPMYJY-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.80 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |