C12H20N2O3S — CID 120725851
1-(2,5-dimethylfuran-3-yl)sulfonyl-2,3-dimethylpiperazine (PubChem CID 120725851) has the molecular formula C12H20N2O3S and a molecular weight of 272.37 g/mol. Its IUPAC name is 1-(2,5-dimethylfuran-3-yl)sulfonyl-2,3-dimethylpiperazine.
| Compound Name | 1-(2,5-dimethylfuran-3-yl)sulfonyl-2,3-dimethylpiperazine |
|---|---|
| PubChem CID | 120725851 |
| Molecular Formula | C12H20N2O3S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 1-(2,5-dimethylfuran-3-yl)sulfonyl-2,3-dimethylpiperazine |
| SMILES | Cc1cc(S(=O)(=O)N2CCNC(C)C2C)c(C)o1 |
| InChI | InChI=1S/C12H20N2O3S/c1-8-7-12(11(4)17-8)18(15,16)14-6-5-13-9(2)10(14)3/h7,9-10,13H,5-6H2,1-4H3 |
| InChIKey | GHXFJDSKFATLGQ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |