C14H20N2O4S — CID 120876607
2,3-dimethyl-1-[(6-methyl-1,3-benzodioxol-5-yl)sulfonyl]piperazine (PubChem CID 120876607) has the molecular formula C14H20N2O4S and a molecular weight of 312.39 g/mol. Its IUPAC name is 2,3-dimethyl-1-[(6-methyl-1,3-benzodioxol-5-yl)sulfonyl]piperazine.
| Compound Name | 2,3-dimethyl-1-[(6-methyl-1,3-benzodioxol-5-yl)sulfonyl]piperazine |
|---|---|
| PubChem CID | 120876607 |
| Molecular Formula | C14H20N2O4S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 2,3-dimethyl-1-[(6-methyl-1,3-benzodioxol-5-yl)sulfonyl]piperazine |
| SMILES | Cc1cc2c(cc1S(=O)(=O)N1CCNC(C)C1C)OCO2 |
| InChI | InChI=1S/C14H20N2O4S/c1-9-6-12-13(20-8-19-12)7-14(9)21(17,18)16-5-4-15-10(2)11(16)3/h6-7,10-11,15H,4-5,8H2,1-3H3 |
| InChIKey | RRVPXAPVBSKVFF-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |