C12H16Cl2N2O2S — CID 120726080
1-(3,5-dichlorophenyl)sulfonyl-2,3-dimethylpiperazine (PubChem CID 120726080) has the molecular formula C12H16Cl2N2O2S and a molecular weight of 323.25 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)sulfonyl-2,3-dimethylpiperazine.
| Compound Name | 1-(3,5-dichlorophenyl)sulfonyl-2,3-dimethylpiperazine |
|---|---|
| PubChem CID | 120726080 |
| Molecular Formula | C12H16Cl2N2O2S |
| Molecular Weight | 323.25 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | 1-(3,5-dichlorophenyl)sulfonyl-2,3-dimethylpiperazine |
| SMILES | CC1NCCN(S(=O)(=O)c2cc(Cl)cc(Cl)c2)C1C |
| InChI | InChI=1S/C12H16Cl2N2O2S/c1-8-9(2)16(4-3-15-8)19(17,18)12-6-10(13)5-11(14)7-12/h5-9,15H,3-4H2,1-2H3 |
| InChIKey | PNMDNZJDFZJZTO-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.25 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |