C13H17ClF2N2O3S — CID 120725618
1-[3-chloro-4-(difluoromethoxy)phenyl]sulfonyl-2,3-dimethylpiperazine (PubChem CID 120725618) has the molecular formula C13H17ClF2N2O3S and a molecular weight of 354.81 g/mol. Its IUPAC name is 1-[3-chloro-4-(difluoromethoxy)phenyl]sulfonyl-2,3-dimethylpiperazine.
| Compound Name | 1-[3-chloro-4-(difluoromethoxy)phenyl]sulfonyl-2,3-dimethylpiperazine |
|---|---|
| PubChem CID | 120725618 |
| Molecular Formula | C13H17ClF2N2O3S |
| Molecular Weight | 354.81 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | 1-[3-chloro-4-(difluoromethoxy)phenyl]sulfonyl-2,3-dimethylpiperazine |
| SMILES | CC1NCCN(S(=O)(=O)c2ccc(OC(F)F)c(Cl)c2)C1C |
| InChI | InChI=1S/C13H17ClF2N2O3S/c1-8-9(2)18(6-5-17-8)22(19,20)10-3-4-12(11(14)7-10)21-13(15)16/h3-4,7-9,13,17H,5-6H2,1-2H3 |
| InChIKey | QGCMHUWVWMDHMH-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.81 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |