C13H18Cl2F2N2O3S — CID 120714814
1-[3-chloro-4-(difluoromethoxy)phenyl]sulfonyl-N-methylpiperidin-3-amine;hydrochloride (PubChem CID 120714814) has the molecular formula C13H18Cl2F2N2O3S and a molecular weight of 391.27 g/mol. Its IUPAC name is 1-[3-chloro-4-(difluoromethoxy)phenyl]sulfonyl-N-methylpiperidin-3-amine;hydrochloride.
| Compound Name | 1-[3-chloro-4-(difluoromethoxy)phenyl]sulfonyl-N-methylpiperidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 120714814 |
| Molecular Formula | C13H18Cl2F2N2O3S |
| Molecular Weight | 391.27 g/mol |
| Exact Mass | 390.04 |
| IUPAC Name | 1-[3-chloro-4-(difluoromethoxy)phenyl]sulfonyl-N-methylpiperidin-3-amine;hydrochloride |
| SMILES | CNC1CCCN(S(=O)(=O)c2ccc(OC(F)F)c(Cl)c2)C1.Cl |
| InChI | InChI=1S/C13H17ClF2N2O3S.ClH/c1-17-9-3-2-6-18(8-9)22(19,20)10-4-5-12(11(14)7-10)21-13(15)16;/h4-5,7,9,13,17H,2-3,6,8H2,1H3;1H |
| InChIKey | HTEQTVHYQNOCDN-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.27 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |