C12H15ClF2N2O3S — CID 102977579
(3R)-1-[3-chloro-4-(difluoromethoxy)phenyl]sulfonylpiperidin-3-amine (PubChem CID 102977579) has the molecular formula C12H15ClF2N2O3S and a molecular weight of 340.78 g/mol. Its IUPAC name is (3R)-1-[3-chloro-4-(difluoromethoxy)phenyl]sulfonylpiperidin-3-amine.
| Compound Name | (3R)-1-[3-chloro-4-(difluoromethoxy)phenyl]sulfonylpiperidin-3-amine |
|---|---|
| PubChem CID | 102977579 |
| Molecular Formula | C12H15ClF2N2O3S |
| Molecular Weight | 340.78 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | (3R)-1-[3-chloro-4-(difluoromethoxy)phenyl]sulfonylpiperidin-3-amine |
| SMILES | N[C@@H]1CCCN(S(=O)(=O)c2ccc(OC(F)F)c(Cl)c2)C1 |
| InChI | InChI=1S/C12H15ClF2N2O3S/c13-10-6-9(3-4-11(10)20-12(14)15)21(18,19)17-5-1-2-8(16)7-17/h3-4,6,8,12H,1-2,5,7,16H2/t8-/m1/s1 |
| InChIKey | KTAUXRWUXARJQF-MRVPVSSYSA-N |
| XLogP | 2.05 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.78 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |