C13H17ClF2N2O3S — CID 119977546
1-[1-[3-chloro-4-(difluoromethoxy)phenyl]sulfonylpyrrolidin-3-yl]-N-methylmethanamine (PubChem CID 119977546) has the molecular formula C13H17ClF2N2O3S and a molecular weight of 354.81 g/mol. Its IUPAC name is 1-[1-[3-chloro-4-(difluoromethoxy)phenyl]sulfonylpyrrolidin-3-yl]-N-methylmethanamine.
| Compound Name | 1-[1-[3-chloro-4-(difluoromethoxy)phenyl]sulfonylpyrrolidin-3-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 119977546 |
| Molecular Formula | C13H17ClF2N2O3S |
| Molecular Weight | 354.81 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | 1-[1-[3-chloro-4-(difluoromethoxy)phenyl]sulfonylpyrrolidin-3-yl]-N-methylmethanamine |
| SMILES | CNCC1CCN(S(=O)(=O)c2ccc(OC(F)F)c(Cl)c2)C1 |
| InChI | InChI=1S/C13H17ClF2N2O3S/c1-17-7-9-4-5-18(8-9)22(19,20)10-2-3-12(11(14)6-10)21-13(15)16/h2-3,6,9,13,17H,4-5,7-8H2,1H3 |
| InChIKey | SMTJKHGVZBRGTG-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.81 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |