C13H18ClN3O4S — CID 120726084
1-(3-chloro-4-methyl-5-nitrophenyl)sulfonyl-2,3-dimethylpiperazine (PubChem CID 120726084) has the molecular formula C13H18ClN3O4S and a molecular weight of 347.82 g/mol. Its IUPAC name is 1-(3-chloro-4-methyl-5-nitrophenyl)sulfonyl-2,3-dimethylpiperazine.
| Compound Name | 1-(3-chloro-4-methyl-5-nitrophenyl)sulfonyl-2,3-dimethylpiperazine |
|---|---|
| PubChem CID | 120726084 |
| Molecular Formula | C13H18ClN3O4S |
| Molecular Weight | 347.82 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | 1-(3-chloro-4-methyl-5-nitrophenyl)sulfonyl-2,3-dimethylpiperazine |
| SMILES | Cc1c(Cl)cc(S(=O)(=O)N2CCNC(C)C2C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H18ClN3O4S/c1-8-12(14)6-11(7-13(8)17(18)19)22(20,21)16-5-4-15-9(2)10(16)3/h6-7,9-10,15H,4-5H2,1-3H3 |
| InChIKey | UPPUTYMWGCDCMT-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.82 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|