C14H18ClN3O4S — CID 120719800
9-(3-chloro-4-methyl-5-nitrophenyl)sulfonyl-3,9-diazabicyclo[4.2.1]nonane (PubChem CID 120719800) has the molecular formula C14H18ClN3O4S and a molecular weight of 359.84 g/mol. Its IUPAC name is 9-(3-chloro-4-methyl-5-nitrophenyl)sulfonyl-3,9-diazabicyclo[4.2.1]nonane.
| Compound Name | 9-(3-chloro-4-methyl-5-nitrophenyl)sulfonyl-3,9-diazabicyclo[4.2.1]nonane |
|---|---|
| PubChem CID | 120719800 |
| Molecular Formula | C14H18ClN3O4S |
| Molecular Weight | 359.84 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | 9-(3-chloro-4-methyl-5-nitrophenyl)sulfonyl-3,9-diazabicyclo[4.2.1]nonane |
| SMILES | Cc1c(Cl)cc(S(=O)(=O)N2C3CCNCC2CC3)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H18ClN3O4S/c1-9-13(15)6-12(7-14(9)18(19)20)23(21,22)17-10-2-3-11(17)8-16-5-4-10/h6-7,10-11,16H,2-5,8H2,1H3 |
| InChIKey | NKRXHUXLBQSVIY-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.84 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|