C14H18Cl2N2O2S — CID 120719225
9-(3,5-dichloro-4-methylphenyl)sulfonyl-3,9-diazabicyclo[4.2.1]nonane (PubChem CID 120719225) has the molecular formula C14H18Cl2N2O2S and a molecular weight of 349.28 g/mol. Its IUPAC name is 9-(3,5-dichloro-4-methylphenyl)sulfonyl-3,9-diazabicyclo[4.2.1]nonane.
| Compound Name | 9-(3,5-dichloro-4-methylphenyl)sulfonyl-3,9-diazabicyclo[4.2.1]nonane |
|---|---|
| PubChem CID | 120719225 |
| Molecular Formula | C14H18Cl2N2O2S |
| Molecular Weight | 349.28 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | 9-(3,5-dichloro-4-methylphenyl)sulfonyl-3,9-diazabicyclo[4.2.1]nonane |
| SMILES | Cc1c(Cl)cc(S(=O)(=O)N2C3CCNCC2CC3)cc1Cl |
| InChI | InChI=1S/C14H18Cl2N2O2S/c1-9-13(15)6-12(7-14(9)16)21(19,20)18-10-2-3-11(18)8-17-5-4-10/h6-7,10-11,17H,2-5,8H2,1H3 |
| InChIKey | XWPPILGXDRJHOV-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.28 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |