C19H28Cl2N2O2S — CID 142200902
1-(3,5-dichloro-4-methylphenyl)sulfonyl-4-(2-piperidin-4-ylethyl)piperidine (PubChem CID 142200902) has the molecular formula C19H28Cl2N2O2S and a molecular weight of 419.42 g/mol. Its IUPAC name is 1-(3,5-dichloro-4-methylphenyl)sulfonyl-4-(2-piperidin-4-ylethyl)piperidine.
| Compound Name | 1-(3,5-dichloro-4-methylphenyl)sulfonyl-4-(2-piperidin-4-ylethyl)piperidine |
|---|---|
| PubChem CID | 142200902 |
| Molecular Formula | C19H28Cl2N2O2S |
| Molecular Weight | 419.42 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | 1-(3,5-dichloro-4-methylphenyl)sulfonyl-4-(2-piperidin-4-ylethyl)piperidine |
| SMILES | Cc1c(Cl)cc(S(=O)(=O)N2CCC(CCC3CCNCC3)CC2)cc1Cl |
| InChI | InChI=1S/C19H28Cl2N2O2S/c1-14-18(20)12-17(13-19(14)21)26(24,25)23-10-6-16(7-11-23)3-2-15-4-8-22-9-5-15/h12-13,15-16,22H,2-11H2,1H3 |
| InChIKey | BTMUVYXLVQCBMN-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.42 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |