C14H18BrCl2NO2S — CID 63421045
1-(4-bromo-2,6-dichlorophenyl)sulfonyl-4-propylpiperidine (PubChem CID 63421045) has the molecular formula C14H18BrCl2NO2S and a molecular weight of 415.18 g/mol. Its IUPAC name is 1-(4-bromo-2,6-dichlorophenyl)sulfonyl-4-propylpiperidine.
| Compound Name | 1-(4-bromo-2,6-dichlorophenyl)sulfonyl-4-propylpiperidine |
|---|---|
| PubChem CID | 63421045 |
| Molecular Formula | C14H18BrCl2NO2S |
| Molecular Weight | 415.18 g/mol |
| Exact Mass | 412.96 |
| IUPAC Name | 1-(4-bromo-2,6-dichlorophenyl)sulfonyl-4-propylpiperidine |
| SMILES | CCCC1CCN(S(=O)(=O)c2c(Cl)cc(Br)cc2Cl)CC1 |
| InChI | InChI=1S/C14H18BrCl2NO2S/c1-2-3-10-4-6-18(7-5-10)21(19,20)14-12(16)8-11(15)9-13(14)17/h8-10H,2-7H2,1H3 |
| InChIKey | DNZONNNPSPNXQK-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.18 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |