C13H16BrCl2NO2S — CID 18228816
1-(4-bromo-2,6-dichlorophenyl)sulfonyl-3,5-dimethylpiperidine (PubChem CID 18228816) has the molecular formula C13H16BrCl2NO2S and a molecular weight of 401.15 g/mol. Its IUPAC name is 1-(4-bromo-2,6-dichlorophenyl)sulfonyl-3,5-dimethylpiperidine.
| Compound Name | 1-(4-bromo-2,6-dichlorophenyl)sulfonyl-3,5-dimethylpiperidine |
|---|---|
| PubChem CID | 18228816 |
| Molecular Formula | C13H16BrCl2NO2S |
| Molecular Weight | 401.15 g/mol |
| Exact Mass | 398.95 |
| IUPAC Name | 1-(4-bromo-2,6-dichlorophenyl)sulfonyl-3,5-dimethylpiperidine |
| SMILES | CC1CC(C)CN(S(=O)(=O)c2c(Cl)cc(Br)cc2Cl)C1 |
| InChI | InChI=1S/C13H16BrCl2NO2S/c1-8-3-9(2)7-17(6-8)20(18,19)13-11(15)4-10(14)5-12(13)16/h4-5,8-9H,3,6-7H2,1-2H3 |
| InChIKey | GXHYBNDPTCUQQB-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.15 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |