C14H19Cl2NO2S — CID 7749543
(3S,5S)-1-(2,4-dichloro-5-methylphenyl)sulfonyl-3,5-dimethylpiperidine (PubChem CID 7749543) has the molecular formula C14H19Cl2NO2S and a molecular weight of 336.28 g/mol. Its IUPAC name is (3S,5S)-1-(2,4-dichloro-5-methylphenyl)sulfonyl-3,5-dimethylpiperidine.
| Compound Name | (3S,5S)-1-(2,4-dichloro-5-methylphenyl)sulfonyl-3,5-dimethylpiperidine |
|---|---|
| PubChem CID | 7749543 |
| Molecular Formula | C14H19Cl2NO2S |
| Molecular Weight | 336.28 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | (3S,5S)-1-(2,4-dichloro-5-methylphenyl)sulfonyl-3,5-dimethylpiperidine |
| SMILES | Cc1cc(S(=O)(=O)N2C[C@@H](C)C[C@H](C)C2)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H19Cl2NO2S/c1-9-4-10(2)8-17(7-9)20(18,19)14-5-11(3)12(15)6-13(14)16/h5-6,9-10H,4,7-8H2,1-3H3/t9-,10-/m0/s1 |
| InChIKey | DXSQJGNHSSDCQD-UWVGGRQHSA-N |
| XLogP | 3.97 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.28 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |