C13H16Cl3NO2S — CID 124680623
(3S,5S)-3,5-dimethyl-1-(2,3,4-trichlorophenyl)sulfonylpiperidine (PubChem CID 124680623) has the molecular formula C13H16Cl3NO2S and a molecular weight of 356.70 g/mol. Its IUPAC name is (3S,5S)-3,5-dimethyl-1-(2,3,4-trichlorophenyl)sulfonylpiperidine.
| Compound Name | (3S,5S)-3,5-dimethyl-1-(2,3,4-trichlorophenyl)sulfonylpiperidine |
|---|---|
| PubChem CID | 124680623 |
| Molecular Formula | C13H16Cl3NO2S |
| Molecular Weight | 356.70 g/mol |
| Exact Mass | 355.00 |
| IUPAC Name | (3S,5S)-3,5-dimethyl-1-(2,3,4-trichlorophenyl)sulfonylpiperidine |
| SMILES | C[C@H]1C[C@H](C)CN(S(=O)(=O)c2ccc(Cl)c(Cl)c2Cl)C1 |
| InChI | InChI=1S/C13H16Cl3NO2S/c1-8-5-9(2)7-17(6-8)20(18,19)11-4-3-10(14)12(15)13(11)16/h3-4,8-9H,5-7H2,1-2H3/t8-,9-/m0/s1 |
| InChIKey | OBTVQDXULWUSOW-IUCAKERBSA-N |
| XLogP | 4.31 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.70 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|