C14H21NO4S2 — CID 31534083
(3S,5R)-3,5-dimethyl-1-(2-methylsulfonylphenyl)sulfonylpiperidine (PubChem CID 31534083) has the molecular formula C14H21NO4S2 and a molecular weight of 331.46 g/mol. Its IUPAC name is (3S,5R)-3,5-dimethyl-1-(2-methylsulfonylphenyl)sulfonylpiperidine.
| Compound Name | (3S,5R)-3,5-dimethyl-1-(2-methylsulfonylphenyl)sulfonylpiperidine |
|---|---|
| PubChem CID | 31534083 |
| Molecular Formula | C14H21NO4S2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | (3S,5R)-3,5-dimethyl-1-(2-methylsulfonylphenyl)sulfonylpiperidine |
| SMILES | C[C@@H]1C[C@H](C)CN(S(=O)(=O)c2ccccc2S(C)(=O)=O)C1 |
| InChI | InChI=1S/C14H21NO4S2/c1-11-8-12(2)10-15(9-11)21(18,19)14-7-5-4-6-13(14)20(3,16)17/h4-7,11-12H,8-10H2,1-3H3/t11-,12+ |
| InChIKey | COLZIARPAHUYQG-TXEJJXNPSA-N |
| XLogP | 1.76 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |