C13H17N3O2S2 — CID 5060907
4-(3,5-dimethylpiperidin-1-yl)sulfonyl-2,1,3-benzothiadiazole (PubChem CID 5060907) has the molecular formula C13H17N3O2S2 and a molecular weight of 311.43 g/mol. Its IUPAC name is 4-(3,5-dimethylpiperidin-1-yl)sulfonyl-2,1,3-benzothiadiazole.
| Compound Name | 4-(3,5-dimethylpiperidin-1-yl)sulfonyl-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 5060907 |
| Molecular Formula | C13H17N3O2S2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | 4-(3,5-dimethylpiperidin-1-yl)sulfonyl-2,1,3-benzothiadiazole |
| SMILES | CC1CC(C)CN(S(=O)(=O)c2cccc3nsnc23)C1 |
| InChI | InChI=1S/C13H17N3O2S2/c1-9-6-10(2)8-16(7-9)20(17,18)12-5-3-4-11-13(12)15-19-14-11/h3-5,9-10H,6-8H2,1-2H3 |
| InChIKey | HEPNTZPLGNAJPU-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |