C11H14N4O2S2 — CID 102977572
(3R)-1-(2,1,3-benzothiadiazol-4-ylsulfonyl)piperidin-3-amine (PubChem CID 102977572) has the molecular formula C11H14N4O2S2 and a molecular weight of 298.39 g/mol. Its IUPAC name is (3R)-1-(2,1,3-benzothiadiazol-4-ylsulfonyl)piperidin-3-amine.
| Compound Name | (3R)-1-(2,1,3-benzothiadiazol-4-ylsulfonyl)piperidin-3-amine |
|---|---|
| PubChem CID | 102977572 |
| Molecular Formula | C11H14N4O2S2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | (3R)-1-(2,1,3-benzothiadiazol-4-ylsulfonyl)piperidin-3-amine |
| SMILES | N[C@@H]1CCCN(S(=O)(=O)c2cccc3nsnc23)C1 |
| InChI | InChI=1S/C11H14N4O2S2/c12-8-3-2-6-15(7-8)19(16,17)10-5-1-4-9-11(10)14-18-13-9/h1,4-5,8H,2-3,6-7,12H2/t8-/m1/s1 |
| InChIKey | WCMCLEJTEKTNTN-MRVPVSSYSA-N |
| XLogP | 0.80 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |