C11H13N3O4S2 — CID 56898413
(3S,4S)-1-(2,1,3-benzothiadiazol-4-ylsulfonyl)piperidine-3,4-diol (PubChem CID 56898413) has the molecular formula C11H13N3O4S2 and a molecular weight of 315.38 g/mol. Its IUPAC name is (3S,4S)-1-(2,1,3-benzothiadiazol-4-ylsulfonyl)piperidine-3,4-diol.
| Compound Name | (3S,4S)-1-(2,1,3-benzothiadiazol-4-ylsulfonyl)piperidine-3,4-diol |
|---|---|
| PubChem CID | 56898413 |
| Molecular Formula | C11H13N3O4S2 |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | (3S,4S)-1-(2,1,3-benzothiadiazol-4-ylsulfonyl)piperidine-3,4-diol |
| SMILES | O=S(=O)(c1cccc2nsnc12)N1CC[C@H](O)[C@@H](O)C1 |
| InChI | InChI=1S/C11H13N3O4S2/c15-8-4-5-14(6-9(8)16)20(17,18)10-3-1-2-7-11(10)13-19-12-7/h1-3,8-9,15-16H,4-6H2/t8-,9-/m0/s1 |
| InChIKey | FGFUVVIREHSFPX-IUCAKERBSA-N |
| XLogP | -0.19 |
| TPSA | 103.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |