C16H16N4O2S2 — CID 22585591
4-(4-pyridin-4-ylpiperidin-1-yl)sulfonyl-2,1,3-benzothiadiazole (PubChem CID 22585591) has the molecular formula C16H16N4O2S2 and a molecular weight of 360.46 g/mol. Its IUPAC name is 4-(4-pyridin-4-ylpiperidin-1-yl)sulfonyl-2,1,3-benzothiadiazole.
| Compound Name | 4-(4-pyridin-4-ylpiperidin-1-yl)sulfonyl-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 22585591 |
| Molecular Formula | C16H16N4O2S2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | 4-(4-pyridin-4-ylpiperidin-1-yl)sulfonyl-2,1,3-benzothiadiazole |
| SMILES | O=S(=O)(c1cccc2nsnc12)N1CCC(c2ccncc2)CC1 |
| InChI | InChI=1S/C16H16N4O2S2/c21-24(22,15-3-1-2-14-16(15)19-23-18-14)20-10-6-13(7-11-20)12-4-8-17-9-5-12/h1-5,8-9,13H,6-7,10-11H2 |
| InChIKey | PWZVFPVWEZHUTO-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 76.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |