C13H17F2NO2S — CID 2409021
(3S,5S)-1-(2,4-difluorophenyl)sulfonyl-3,5-dimethylpiperidine (PubChem CID 2409021) has the molecular formula C13H17F2NO2S and a molecular weight of 289.35 g/mol. Its IUPAC name is (3S,5S)-1-(2,4-difluorophenyl)sulfonyl-3,5-dimethylpiperidine.
| Compound Name | (3S,5S)-1-(2,4-difluorophenyl)sulfonyl-3,5-dimethylpiperidine |
|---|---|
| PubChem CID | 2409021 |
| Molecular Formula | C13H17F2NO2S |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | (3S,5S)-1-(2,4-difluorophenyl)sulfonyl-3,5-dimethylpiperidine |
| SMILES | C[C@H]1C[C@H](C)CN(S(=O)(=O)c2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C13H17F2NO2S/c1-9-5-10(2)8-16(7-9)19(17,18)13-4-3-11(14)6-12(13)15/h3-4,6,9-10H,5,7-8H2,1-2H3/t9-,10-/m0/s1 |
| InChIKey | QOXOOHHITIKMMG-UWVGGRQHSA-N |
| XLogP | 2.63 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |