C11H12ClF2NO2S — CID 63400627
3-(chloromethyl)-1-(2,4-difluorophenyl)sulfonylpyrrolidine (PubChem CID 63400627) has the molecular formula C11H12ClF2NO2S and a molecular weight of 295.74 g/mol. Its IUPAC name is 3-(chloromethyl)-1-(2,4-difluorophenyl)sulfonylpyrrolidine.
| Compound Name | 3-(chloromethyl)-1-(2,4-difluorophenyl)sulfonylpyrrolidine |
|---|---|
| PubChem CID | 63400627 |
| Molecular Formula | C11H12ClF2NO2S |
| Molecular Weight | 295.74 g/mol |
| Exact Mass | 295.02 |
| IUPAC Name | 3-(chloromethyl)-1-(2,4-difluorophenyl)sulfonylpyrrolidine |
| SMILES | O=S(=O)(c1ccc(F)cc1F)N1CCC(CCl)C1 |
| InChI | InChI=1S/C11H12ClF2NO2S/c12-6-8-3-4-15(7-8)18(16,17)11-2-1-9(13)5-10(11)14/h1-2,5,8H,3-4,6-7H2 |
| InChIKey | WOSWNTHCFDXTBP-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.74 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|