C14H20F2N2O2S — CID 63879108
N-[[1-(2,4-difluorophenyl)sulfonylpiperidin-3-yl]methyl]ethanamine (PubChem CID 63879108) has the molecular formula C14H20F2N2O2S and a molecular weight of 318.39 g/mol. Its IUPAC name is N-[[1-(2,4-difluorophenyl)sulfonylpiperidin-3-yl]methyl]ethanamine.
| Compound Name | N-[[1-(2,4-difluorophenyl)sulfonylpiperidin-3-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 63879108 |
| Molecular Formula | C14H20F2N2O2S |
| Molecular Weight | 318.39 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | N-[[1-(2,4-difluorophenyl)sulfonylpiperidin-3-yl]methyl]ethanamine |
| SMILES | CCNCC1CCCN(S(=O)(=O)c2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C14H20F2N2O2S/c1-2-17-9-11-4-3-7-18(10-11)21(19,20)14-6-5-12(15)8-13(14)16/h5-6,8,11,17H,2-4,7,9-10H2,1H3 |
| InChIKey | VMRATUQDLLLKTN-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.39 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |