C11H12F3NO2S — CID 142458057
1-(2,4-difluorophenyl)sulfonyl-3-fluoropiperidine (PubChem CID 142458057) has the molecular formula C11H12F3NO2S and a molecular weight of 279.28 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)sulfonyl-3-fluoropiperidine.
| Compound Name | 1-(2,4-difluorophenyl)sulfonyl-3-fluoropiperidine |
|---|---|
| PubChem CID | 142458057 |
| Molecular Formula | C11H12F3NO2S |
| Molecular Weight | 279.28 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | 1-(2,4-difluorophenyl)sulfonyl-3-fluoropiperidine |
| SMILES | O=S(=O)(c1ccc(F)cc1F)N1CCCC(F)C1 |
| InChI | InChI=1S/C11H12F3NO2S/c12-8-3-4-11(10(14)6-8)18(16,17)15-5-1-2-9(13)7-15/h3-4,6,9H,1-2,5,7H2 |
| InChIKey | SUNXPCHZGGXSMA-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.28 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |