C12H15F2N3O3S — CID 77038290
1-(2,4-difluorophenyl)sulfonyl-N'-hydroxypiperidine-4-carboximidamide (PubChem CID 77038290) has the molecular formula C12H15F2N3O3S and a molecular weight of 319.33 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)sulfonyl-N'-hydroxypiperidine-4-carboximidamide.
| Compound Name | 1-(2,4-difluorophenyl)sulfonyl-N'-hydroxypiperidine-4-carboximidamide |
|---|---|
| PubChem CID | 77038290 |
| Molecular Formula | C12H15F2N3O3S |
| Molecular Weight | 319.33 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 1-(2,4-difluorophenyl)sulfonyl-N'-hydroxypiperidine-4-carboximidamide |
| SMILES | NC(=NO)C1CCN(S(=O)(=O)c2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C12H15F2N3O3S/c13-9-1-2-11(10(14)7-9)21(19,20)17-5-3-8(4-6-17)12(15)16-18/h1-2,7-8,18H,3-6H2,(H2,15,16) |
| InChIKey | PNRDHFYQPFYKCF-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.33 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|