C15H20F2N2O3S — CID 60599241
1-(2,4-difluorophenyl)sulfonyl-N-propan-2-ylpiperidine-4-carboxamide (PubChem CID 60599241) has the molecular formula C15H20F2N2O3S and a molecular weight of 346.40 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)sulfonyl-N-propan-2-ylpiperidine-4-carboxamide.
| Compound Name | 1-(2,4-difluorophenyl)sulfonyl-N-propan-2-ylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 60599241 |
| Molecular Formula | C15H20F2N2O3S |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 1-(2,4-difluorophenyl)sulfonyl-N-propan-2-ylpiperidine-4-carboxamide |
| SMILES | CC(C)NC(=O)C1CCN(S(=O)(=O)c2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C15H20F2N2O3S/c1-10(2)18-15(20)11-5-7-19(8-6-11)23(21,22)14-4-3-12(16)9-13(14)17/h3-4,9-11H,5-8H2,1-2H3,(H,18,20) |
| InChIKey | JWVTUXGLLXKHES-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |