C11H12F2N2O3S2 — CID 79674677
4-(2,4-difluorophenyl)sulfonylmorpholine-2-carbothioamide (PubChem CID 79674677) has the molecular formula C11H12F2N2O3S2 and a molecular weight of 322.36 g/mol. Its IUPAC name is 4-(2,4-difluorophenyl)sulfonylmorpholine-2-carbothioamide.
| Compound Name | 4-(2,4-difluorophenyl)sulfonylmorpholine-2-carbothioamide |
|---|---|
| PubChem CID | 79674677 |
| Molecular Formula | C11H12F2N2O3S2 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | 4-(2,4-difluorophenyl)sulfonylmorpholine-2-carbothioamide |
| SMILES | NC(=S)C1CN(S(=O)(=O)c2ccc(F)cc2F)CCO1 |
| InChI | InChI=1S/C11H12F2N2O3S2/c12-7-1-2-10(8(13)5-7)20(16,17)15-3-4-18-9(6-15)11(14)19/h1-2,5,9H,3-4,6H2,(H2,14,19) |
| InChIKey | SFZSTKLHIFDKSO-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|