C12H15F2N3O2S2 — CID 9096997
4-(2,4-difluorophenyl)sulfonyl-N-methylpiperazine-1-carbothioamide (PubChem CID 9096997) has the molecular formula C12H15F2N3O2S2 and a molecular weight of 335.40 g/mol. Its IUPAC name is 4-(2,4-difluorophenyl)sulfonyl-N-methylpiperazine-1-carbothioamide.
| Compound Name | 4-(2,4-difluorophenyl)sulfonyl-N-methylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 9096997 |
| Molecular Formula | C12H15F2N3O2S2 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | 4-(2,4-difluorophenyl)sulfonyl-N-methylpiperazine-1-carbothioamide |
| SMILES | CNC(=S)N1CCN(S(=O)(=O)c2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C12H15F2N3O2S2/c1-15-12(20)16-4-6-17(7-5-16)21(18,19)11-3-2-9(13)8-10(11)14/h2-3,8H,4-7H2,1H3,(H,15,20) |
| InChIKey | GVRKGYBHMVLHLO-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|