C21H26F2N2O3S — CID 55388020
2-adamantyl-[4-(2,4-difluorophenyl)sulfonylpiperazin-1-yl]methanone (PubChem CID 55388020) has the molecular formula C21H26F2N2O3S and a molecular weight of 424.51 g/mol. Its IUPAC name is 2-adamantyl-[4-(2,4-difluorophenyl)sulfonylpiperazin-1-yl]methanone.
| Compound Name | 2-adamantyl-[4-(2,4-difluorophenyl)sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 55388020 |
| Molecular Formula | C21H26F2N2O3S |
| Molecular Weight | 424.51 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | 2-adamantyl-[4-(2,4-difluorophenyl)sulfonylpiperazin-1-yl]methanone |
| SMILES | O=C(C1C2CC3CC(C2)CC1C3)N1CCN(S(=O)(=O)c2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C21H26F2N2O3S/c22-17-1-2-19(18(23)12-17)29(27,28)25-5-3-24(4-6-25)21(26)20-15-8-13-7-14(10-15)11-16(20)9-13/h1-2,12-16,20H,3-11H2 |
| InChIKey | SGSBHSDMAKVGTP-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.51 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |