C13H14F2N2O3S — CID 167882186
1-[4-(2,4-difluorophenyl)sulfonylpiperazin-1-yl]prop-2-en-1-one (PubChem CID 167882186) has the molecular formula C13H14F2N2O3S and a molecular weight of 316.33 g/mol. Its IUPAC name is 1-[4-(2,4-difluorophenyl)sulfonylpiperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-(2,4-difluorophenyl)sulfonylpiperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 167882186 |
| Molecular Formula | C13H14F2N2O3S |
| Molecular Weight | 316.33 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 1-[4-(2,4-difluorophenyl)sulfonylpiperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(S(=O)(=O)c2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C13H14F2N2O3S/c1-2-13(18)16-5-7-17(8-6-16)21(19,20)12-4-3-10(14)9-11(12)15/h2-4,9H,1,5-8H2 |
| InChIKey | LMIOAOYTKSMGNF-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.33 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|