C22H24F2N2O6S — CID 26381450
(E)-1-[4-(2,4-difluorophenyl)sulfonylpiperazin-1-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one (PubChem CID 26381450) has the molecular formula C22H24F2N2O6S and a molecular weight of 482.51 g/mol. Its IUPAC name is (E)-1-[4-(2,4-difluorophenyl)sulfonylpiperazin-1-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-(2,4-difluorophenyl)sulfonylpiperazin-1-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 26381450 |
| Molecular Formula | C22H24F2N2O6S |
| Molecular Weight | 482.51 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | (E)-1-[4-(2,4-difluorophenyl)sulfonylpiperazin-1-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1cc(/C=C/C(=O)N2CCN(S(=O)(=O)c3ccc(F)cc3F)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C22H24F2N2O6S/c1-30-18-12-15(13-19(31-2)22(18)32-3)4-7-21(27)25-8-10-26(11-9-25)33(28,29)20-6-5-16(23)14-17(20)24/h4-7,12-14H,8-11H2,1-3H3/b7-4+ |
| InChIKey | AOQVABBGLAPKLV-QPJJXVBHSA-N |
| XLogP | 2.54 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.51 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|