C22H23F3N2O5S — CID 26470016
(E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]-1-[4-(4-fluorophenyl)sulfonyl-1,4-diazepan-1-yl]prop-2-en-1-one (PubChem CID 26470016) has the molecular formula C22H23F3N2O5S and a molecular weight of 484.50 g/mol. Its IUPAC name is (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]-1-[4-(4-fluorophenyl)sulfonyl-1,4-diazepan-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]-1-[4-(4-fluorophenyl)sulfonyl-1,4-diazepan-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 26470016 |
| Molecular Formula | C22H23F3N2O5S |
| Molecular Weight | 484.50 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]-1-[4-(4-fluorophenyl)sulfonyl-1,4-diazepan-1-yl]prop-2-en-1-one |
| SMILES | COc1cc(/C=C/C(=O)N2CCCN(S(=O)(=O)c3ccc(F)cc3)CC2)ccc1OC(F)F |
| InChI | InChI=1S/C22H23F3N2O5S/c1-31-20-15-16(3-9-19(20)32-22(24)25)4-10-21(28)26-11-2-12-27(14-13-26)33(29,30)18-7-5-17(23)6-8-18/h3-10,15,22H,2,11-14H2,1H3/b10-4+ |
| InChIKey | AJJHIXPWPHAQMT-ONNFQVAWSA-N |
| XLogP | 3.37 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.50 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|