C25H32N2O6S — CID 26868796
(E)-3-(4-butoxy-3-methoxyphenyl)-1-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]prop-2-en-1-one (PubChem CID 26868796) has the molecular formula C25H32N2O6S and a molecular weight of 488.61 g/mol. Its IUPAC name is (E)-3-(4-butoxy-3-methoxyphenyl)-1-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(4-butoxy-3-methoxyphenyl)-1-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 26868796 |
| Molecular Formula | C25H32N2O6S |
| Molecular Weight | 488.61 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | (E)-3-(4-butoxy-3-methoxyphenyl)-1-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]prop-2-en-1-one |
| SMILES | CCCCOc1ccc(/C=C/C(=O)N2CCN(S(=O)(=O)c3ccc(OC)cc3)CC2)cc1OC |
| InChI | InChI=1S/C25H32N2O6S/c1-4-5-18-33-23-12-6-20(19-24(23)32-3)7-13-25(28)26-14-16-27(17-15-26)34(29,30)22-10-8-21(31-2)9-11-22/h6-13,19H,4-5,14-18H2,1-3H3/b13-7+ |
| InChIKey | ZBGNUNWETHHEBF-NTUHNPAUSA-N |
| XLogP | 3.43 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.61 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|