C26H30N2O6 — CID 4690668
3-(3,4-dimethoxyphenyl)-1-[4-[3-(3,4-dimethoxyphenyl)prop-2-enoyl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 4690668) has the molecular formula C26H30N2O6 and a molecular weight of 466.53 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-1-[4-[3-(3,4-dimethoxyphenyl)prop-2-enoyl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 3-(3,4-dimethoxyphenyl)-1-[4-[3-(3,4-dimethoxyphenyl)prop-2-enoyl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 4690668 |
| Molecular Formula | C26H30N2O6 |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-1-[4-[3-(3,4-dimethoxyphenyl)prop-2-enoyl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | COc1ccc(C=CC(=O)N2CCN(C(=O)C=Cc3ccc(OC)c(OC)c3)CC2)cc1OC |
| InChI | InChI=1S/C26H30N2O6/c1-31-21-9-5-19(17-23(21)33-3)7-11-25(29)27-13-15-28(16-14-27)26(30)12-8-20-6-10-22(32-2)24(18-20)34-4/h5-12,17-18H,13-16H2,1-4H3 |
| InChIKey | FEXJREDFAZTOJX-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|