C18H23N3O3 — CID 54788106
3-[4-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]piperazin-1-yl]propanenitrile (PubChem CID 54788106) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is 3-[4-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]piperazin-1-yl]propanenitrile.
| Compound Name | 3-[4-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]piperazin-1-yl]propanenitrile |
|---|---|
| PubChem CID | 54788106 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 3-[4-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]piperazin-1-yl]propanenitrile |
| SMILES | COc1ccc(/C=C/C(=O)N2CCN(CCC#N)CC2)cc1OC |
| InChI | InChI=1S/C18H23N3O3/c1-23-16-6-4-15(14-17(16)24-2)5-7-18(22)21-12-10-20(11-13-21)9-3-8-19/h4-7,14H,3,9-13H2,1-2H3/b7-5+ |
| InChIKey | NSKNUSNITNTLLO-FNORWQNLSA-N |
| XLogP | 1.77 |
| TPSA | 65.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|