C19H27N3O5 — CID 70536818
3-[4-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]piperazin-1-yl]propanamide (PubChem CID 70536818) has the molecular formula C19H27N3O5 and a molecular weight of 377.44 g/mol. Its IUPAC name is 3-[4-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]piperazin-1-yl]propanamide.
| Compound Name | 3-[4-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 70536818 |
| Molecular Formula | C19H27N3O5 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | 3-[4-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]piperazin-1-yl]propanamide |
| SMILES | COc1cc(/C=C/C(=O)N2CCN(CCC(N)=O)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C19H27N3O5/c1-25-15-12-14(13-16(26-2)19(15)27-3)4-5-18(24)22-10-8-21(9-11-22)7-6-17(20)23/h4-5,12-13H,6-11H2,1-3H3,(H2,20,23)/b5-4+ |
| InChIKey | IIGJXARNIZAAKU-SNAWJCMRSA-N |
| XLogP | 0.75 |
| TPSA | 94.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|