C35H48N2O8 — CID 71502335
(E)-6-[4-[(E)-4-oxo-6-(3,4,5-trimethoxyphenyl)hex-5-enyl]-1,4-diazepan-1-yl]-1-(3,4,5-trimethoxyphenyl)hex-1-en-3-one (PubChem CID 71502335) has the molecular formula C35H48N2O8 and a molecular weight of 624.78 g/mol. Its IUPAC name is (E)-6-[4-[(E)-4-oxo-6-(3,4,5-trimethoxyphenyl)hex-5-enyl]-1,4-diazepan-1-yl]-1-(3,4,5-trimethoxyphenyl)hex-1-en-3-one.
| Compound Name | (E)-6-[4-[(E)-4-oxo-6-(3,4,5-trimethoxyphenyl)hex-5-enyl]-1,4-diazepan-1-yl]-1-(3,4,5-trimethoxyphenyl)hex-1-en-3-one |
|---|---|
| PubChem CID | 71502335 |
| Molecular Formula | C35H48N2O8 |
| Molecular Weight | 624.78 g/mol |
| Exact Mass | 624.34 |
| IUPAC Name | (E)-6-[4-[(E)-4-oxo-6-(3,4,5-trimethoxyphenyl)hex-5-enyl]-1,4-diazepan-1-yl]-1-(3,4,5-trimethoxyphenyl)hex-1-en-3-one |
| SMILES | COc1cc(/C=C/C(=O)CCCN2CCCN(CCCC(=O)/C=C/c3cc(OC)c(OC)c(OC)c3)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C35H48N2O8/c1-40-30-22-26(23-31(41-2)34(30)44-5)12-14-28(38)10-7-16-36-18-9-19-37(21-20-36)17-8-11-29(39)15-13-27-24-32(42-3)35(45-6)33(25-27)43-4/h12-15,22-25H,7-11,16-21H2,1-6H3/b14-12+,15-13+ |
| InChIKey | PTDGJAZMGQCTFX-QUMQEAAQSA-N |
| XLogP | 5.17 |
| TPSA | 96.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.78 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|