C29H46N4O10S2 — CID 15728778
3,4,5-trimethoxy-N-[3-[4-[3-[(3,4,5-trimethoxyphenyl)sulfonylamino]propyl]-1,4-diazepan-1-yl]propyl]benzenesulfonamide (PubChem CID 15728778) has the molecular formula C29H46N4O10S2 and a molecular weight of 674.84 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[3-[4-[3-[(3,4,5-trimethoxyphenyl)sulfonylamino]propyl]-1,4-diazepan-1-yl]propyl]benzenesulfonamide.
| Compound Name | 3,4,5-trimethoxy-N-[3-[4-[3-[(3,4,5-trimethoxyphenyl)sulfonylamino]propyl]-1,4-diazepan-1-yl]propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 15728778 |
| Molecular Formula | C29H46N4O10S2 |
| Molecular Weight | 674.84 g/mol |
| Exact Mass | 674.27 |
| IUPAC Name | 3,4,5-trimethoxy-N-[3-[4-[3-[(3,4,5-trimethoxyphenyl)sulfonylamino]propyl]-1,4-diazepan-1-yl]propyl]benzenesulfonamide |
| SMILES | COc1cc(S(=O)(=O)NCCCN2CCCN(CCCNS(=O)(=O)c3cc(OC)c(OC)c(OC)c3)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C29H46N4O10S2/c1-38-24-18-22(19-25(39-2)28(24)42-5)44(34,35)30-10-7-12-32-14-9-15-33(17-16-32)13-8-11-31-45(36,37)23-20-26(40-3)29(43-6)27(21-23)41-4/h18-21,30-31H,7-17H2,1-6H3 |
| InChIKey | ZGOWGBDUDQUNJQ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 154.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.84 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|