C29H46N4O6 — CID 15728776
3,4,5-trimethoxy-N-[3-[4-[3-(3,4,5-trimethoxyanilino)propyl]-1,4-diazepan-1-yl]propyl]aniline (PubChem CID 15728776) has the molecular formula C29H46N4O6 and a molecular weight of 546.71 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[3-[4-[3-(3,4,5-trimethoxyanilino)propyl]-1,4-diazepan-1-yl]propyl]aniline.
| Compound Name | 3,4,5-trimethoxy-N-[3-[4-[3-(3,4,5-trimethoxyanilino)propyl]-1,4-diazepan-1-yl]propyl]aniline |
|---|---|
| PubChem CID | 15728776 |
| Molecular Formula | C29H46N4O6 |
| Molecular Weight | 546.71 g/mol |
| Exact Mass | 546.34 |
| IUPAC Name | 3,4,5-trimethoxy-N-[3-[4-[3-(3,4,5-trimethoxyanilino)propyl]-1,4-diazepan-1-yl]propyl]aniline |
| SMILES | COc1cc(NCCCN2CCCN(CCCNc3cc(OC)c(OC)c(OC)c3)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C29H46N4O6/c1-34-24-18-22(19-25(35-2)28(24)38-5)30-10-7-12-32-14-9-15-33(17-16-32)13-8-11-31-23-20-26(36-3)29(39-6)27(21-23)37-4/h18-21,30-31H,7-17H2,1-6H3 |
| InChIKey | YDVAIVKJEJNLJJ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 85.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.71 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|