C15H25NO5 — CID 103409297
3,4,5-trimethoxy-N-[3-(2-methoxyethoxy)propyl]aniline (PubChem CID 103409297) has the molecular formula C15H25NO5 and a molecular weight of 299.37 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[3-(2-methoxyethoxy)propyl]aniline.
| Compound Name | 3,4,5-trimethoxy-N-[3-(2-methoxyethoxy)propyl]aniline |
|---|---|
| PubChem CID | 103409297 |
| Molecular Formula | C15H25NO5 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 3,4,5-trimethoxy-N-[3-(2-methoxyethoxy)propyl]aniline |
| SMILES | COCCOCCCNc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C15H25NO5/c1-17-8-9-21-7-5-6-16-12-10-13(18-2)15(20-4)14(11-12)19-3/h10-11,16H,5-9H2,1-4H3 |
| InChIKey | WKAKWHRWUBYQBH-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 58.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|