C16H24N2O3 — CID 65257056
2,2-dimethyl-5-(3,4,5-trimethoxyanilino)pentanenitrile (PubChem CID 65257056) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is 2,2-dimethyl-5-(3,4,5-trimethoxyanilino)pentanenitrile.
| Compound Name | 2,2-dimethyl-5-(3,4,5-trimethoxyanilino)pentanenitrile |
|---|---|
| PubChem CID | 65257056 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 2,2-dimethyl-5-(3,4,5-trimethoxyanilino)pentanenitrile |
| SMILES | COc1cc(NCCCC(C)(C)C#N)cc(OC)c1OC |
| InChI | InChI=1S/C16H24N2O3/c1-16(2,11-17)7-6-8-18-12-9-13(19-3)15(21-5)14(10-12)20-4/h9-10,18H,6-8H2,1-5H3 |
| InChIKey | PNMZFWCZIWFHEB-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 63.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|