C13H17FN2 — CID 65256904
5-(3-fluoroanilino)-2,2-dimethylpentanenitrile (PubChem CID 65256904) has the molecular formula C13H17FN2 and a molecular weight of 220.29 g/mol. Its IUPAC name is 5-(3-fluoroanilino)-2,2-dimethylpentanenitrile.
| Compound Name | 5-(3-fluoroanilino)-2,2-dimethylpentanenitrile |
|---|---|
| PubChem CID | 65256904 |
| Molecular Formula | C13H17FN2 |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | 5-(3-fluoroanilino)-2,2-dimethylpentanenitrile |
| SMILES | CC(C)(C#N)CCCNc1cccc(F)c1 |
| InChI | InChI=1S/C13H17FN2/c1-13(2,10-15)7-4-8-16-12-6-3-5-11(14)9-12/h3,5-6,9,16H,4,7-8H2,1-2H3 |
| InChIKey | QUMOYUDCVQMWLF-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|