C15H21FN2 — CID 106709977
6-(3-fluoro-N-methylanilino)-2,2-dimethylhexanenitrile (PubChem CID 106709977) has the molecular formula C15H21FN2 and a molecular weight of 248.34 g/mol. Its IUPAC name is 6-(3-fluoro-N-methylanilino)-2,2-dimethylhexanenitrile.
| Compound Name | 6-(3-fluoro-N-methylanilino)-2,2-dimethylhexanenitrile |
|---|---|
| PubChem CID | 106709977 |
| Molecular Formula | C15H21FN2 |
| Molecular Weight | 248.34 g/mol |
| Exact Mass | 248.17 |
| IUPAC Name | 6-(3-fluoro-N-methylanilino)-2,2-dimethylhexanenitrile |
| SMILES | CN(CCCCC(C)(C)C#N)c1cccc(F)c1 |
| InChI | InChI=1S/C15H21FN2/c1-15(2,12-17)9-4-5-10-18(3)14-8-6-7-13(16)11-14/h6-8,11H,4-5,9-10H2,1-3H3 |
| InChIKey | GROVVGMESRTNNA-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.34 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|