C13H16FNO — CID 65255391
5-(3-fluorophenoxy)-2,2-dimethylpentanenitrile (PubChem CID 65255391) has the molecular formula C13H16FNO and a molecular weight of 221.28 g/mol. Its IUPAC name is 5-(3-fluorophenoxy)-2,2-dimethylpentanenitrile.
| Compound Name | 5-(3-fluorophenoxy)-2,2-dimethylpentanenitrile |
|---|---|
| PubChem CID | 65255391 |
| Molecular Formula | C13H16FNO |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 5-(3-fluorophenoxy)-2,2-dimethylpentanenitrile |
| SMILES | CC(C)(C#N)CCCOc1cccc(F)c1 |
| InChI | InChI=1S/C13H16FNO/c1-13(2,10-15)7-4-8-16-12-6-3-5-11(14)9-12/h3,5-6,9H,4,7-8H2,1-2H3 |
| InChIKey | BYVYMYCHKMUYSA-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|