C14H18ClNO — CID 65255992
5-[3-(chloromethyl)phenoxy]-2,2-dimethylpentanenitrile (PubChem CID 65255992) has the molecular formula C14H18ClNO and a molecular weight of 251.76 g/mol. Its IUPAC name is 5-[3-(chloromethyl)phenoxy]-2,2-dimethylpentanenitrile.
| Compound Name | 5-[3-(chloromethyl)phenoxy]-2,2-dimethylpentanenitrile |
|---|---|
| PubChem CID | 65255992 |
| Molecular Formula | C14H18ClNO |
| Molecular Weight | 251.76 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 5-[3-(chloromethyl)phenoxy]-2,2-dimethylpentanenitrile |
| SMILES | CC(C)(C#N)CCCOc1cccc(CCl)c1 |
| InChI | InChI=1S/C14H18ClNO/c1-14(2,11-16)7-4-8-17-13-6-3-5-12(9-13)10-15/h3,5-6,9H,4,7-8,10H2,1-2H3 |
| InChIKey | YPPAVWZPKLBKKW-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.76 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|