C18H27NO — CID 106710429
6-(3-tert-butylphenoxy)-2,2-dimethylhexanenitrile (PubChem CID 106710429) has the molecular formula C18H27NO and a molecular weight of 273.42 g/mol. Its IUPAC name is 6-(3-tert-butylphenoxy)-2,2-dimethylhexanenitrile.
| Compound Name | 6-(3-tert-butylphenoxy)-2,2-dimethylhexanenitrile |
|---|---|
| PubChem CID | 106710429 |
| Molecular Formula | C18H27NO |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | 6-(3-tert-butylphenoxy)-2,2-dimethylhexanenitrile |
| SMILES | CC(C)(C#N)CCCCOc1cccc(C(C)(C)C)c1 |
| InChI | InChI=1S/C18H27NO/c1-17(2,3)15-9-8-10-16(13-15)20-12-7-6-11-18(4,5)14-19/h8-10,13H,6-7,11-12H2,1-5H3 |
| InChIKey | PUTMAFFURBJDGR-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|