C16H24N2O — CID 106708838
6-[3-[(1R)-1-aminoethyl]phenoxy]-2,2-dimethylhexanenitrile (PubChem CID 106708838) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is 6-[3-[(1R)-1-aminoethyl]phenoxy]-2,2-dimethylhexanenitrile.
| Compound Name | 6-[3-[(1R)-1-aminoethyl]phenoxy]-2,2-dimethylhexanenitrile |
|---|---|
| PubChem CID | 106708838 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 6-[3-[(1R)-1-aminoethyl]phenoxy]-2,2-dimethylhexanenitrile |
| SMILES | C[C@@H](N)c1cccc(OCCCCC(C)(C)C#N)c1 |
| InChI | InChI=1S/C16H24N2O/c1-13(18)14-7-6-8-15(11-14)19-10-5-4-9-16(2,3)12-17/h6-8,11,13H,4-5,9-10,18H2,1-3H3/t13-/m1/s1 |
| InChIKey | GOSXFRVVBRJGAF-CYBMUJFWSA-N |
| XLogP | 3.81 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|