C15H22N2O — CID 65256729
5-[3-(1-aminoethyl)phenoxy]-2,2-dimethylpentanenitrile (PubChem CID 65256729) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is 5-[3-(1-aminoethyl)phenoxy]-2,2-dimethylpentanenitrile.
| Compound Name | 5-[3-(1-aminoethyl)phenoxy]-2,2-dimethylpentanenitrile |
|---|---|
| PubChem CID | 65256729 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | 5-[3-(1-aminoethyl)phenoxy]-2,2-dimethylpentanenitrile |
| SMILES | CC(N)c1cccc(OCCCC(C)(C)C#N)c1 |
| InChI | InChI=1S/C15H22N2O/c1-12(17)13-6-4-7-14(10-13)18-9-5-8-15(2,3)11-16/h4,6-7,10,12H,5,8-9,17H2,1-3H3 |
| InChIKey | KOZGFMXWXUNWAA-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|